C21H30N3OS+ — CID 8656279
[(1R)-1-(3-methoxyphenyl)-2-[(4-propan-2-ylphenyl)carbamothioylamino]ethyl]-dimethylazanium (PubChem CID 8656279) has the molecular formula C21H30N3OS+ and a molecular weight of 372.56 g/mol. Its IUPAC name is [(1R)-1-(3-methoxyphenyl)-2-[(4-propan-2-ylphenyl)carbamothioylamino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(3-methoxyphenyl)-2-[(4-propan-2-ylphenyl)carbamothioylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8656279 |
| Molecular Formula | C21H30N3OS+ |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [(1R)-1-(3-methoxyphenyl)-2-[(4-propan-2-ylphenyl)carbamothioylamino]ethyl]-dimethylazanium |
| SMILES | COc1cccc([C@H](CNC(=S)Nc2ccc(C(C)C)cc2)[NH+](C)C)c1 |
| InChI | InChI=1S/C21H29N3OS/c1-15(2)16-9-11-18(12-10-16)23-21(26)22-14-20(24(3)4)17-7-6-8-19(13-17)25-5/h6-13,15,20H,14H2,1-5H3,(H2,22,23,26)/p+1/t20-/m0/s1 |
| InChIKey | GSWNCLMWJYUSGU-FQEVSTJZSA-O |
| XLogP | 2.99 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|