C18H22ClN4O3S+ — CID 8678995
[(1R)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-(3-methoxyphenyl)ethyl]-dimethylazanium (PubChem CID 8678995) has the molecular formula C18H22ClN4O3S+ and a molecular weight of 409.92 g/mol. Its IUPAC name is [(1R)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-(3-methoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-(3-methoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8678995 |
| Molecular Formula | C18H22ClN4O3S+ |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [(1R)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-(3-methoxyphenyl)ethyl]-dimethylazanium |
| SMILES | COc1cccc([C@H](CNC(=S)Nc2cc([N+](=O)[O-])ccc2Cl)[NH+](C)C)c1 |
| InChI | InChI=1S/C18H21ClN4O3S/c1-22(2)17(12-5-4-6-14(9-12)26-3)11-20-18(27)21-16-10-13(23(24)25)7-8-15(16)19/h4-10,17H,11H2,1-3H3,(H2,20,21,27)/p+1/t17-/m0/s1 |
| InChIKey | MSNCAUPMUMEGCE-KRWDZBQOSA-O |
| XLogP | 2.43 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|