C15H18ClN4O2S2+ — CID 7945311
[(1S)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 7945311) has the molecular formula C15H18ClN4O2S2+ and a molecular weight of 385.92 g/mol. Its IUPAC name is [(1S)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7945311 |
| Molecular Formula | C15H18ClN4O2S2+ |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | [(1S)-2-[(2-chloro-5-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=S)Nc1cc([N+](=O)[O-])ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C15H17ClN4O2S2/c1-19(2)13(14-4-3-7-24-14)9-17-15(23)18-12-8-10(20(21)22)5-6-11(12)16/h3-8,13H,9H2,1-2H3,(H2,17,18,23)/p+1/t13-/m0/s1 |
| InChIKey | INHGLCHLPJGTIP-ZDUSSCGKSA-O |
| XLogP | 2.48 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|