C18H22ClN3O2S — CID 8744342
1-(1-adamantylmethyl)-3-(2-chloro-5-nitrophenyl)thiourea (PubChem CID 8744342) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-(2-chloro-5-nitrophenyl)thiourea.
| Compound Name | 1-(1-adamantylmethyl)-3-(2-chloro-5-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8744342 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-(2-chloro-5-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(NC(=S)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C18H22ClN3O2S/c19-15-2-1-14(22(23)24)6-16(15)21-17(25)20-10-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13H,3-5,7-10H2,(H2,20,21,25) |
| InChIKey | ROGXYROPGDDVAO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|