C20H23ClN2O5 — CID 7813387
[2-(1-adamantylmethylamino)-2-oxoethyl] 2-chloro-5-nitrobenzoate (PubChem CID 7813387) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 7813387 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 2-chloro-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1Cl)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H23ClN2O5/c21-17-2-1-15(23(26)27)6-16(17)19(25)28-10-18(24)22-11-20-7-12-3-13(8-20)5-14(4-12)9-20/h1-2,6,12-14H,3-5,7-11H2,(H,22,24) |
| InChIKey | FQAKYGUYAZLCHA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|