C11H14ClN5O3S2 — CID 8654300
1-(2-chloro-5-nitrophenyl)-3-(2-methoxyethylcarbamothioylamino)thiourea (PubChem CID 8654300) has the molecular formula C11H14ClN5O3S2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-3-(2-methoxyethylcarbamothioylamino)thiourea.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-3-(2-methoxyethylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8654300 |
| Molecular Formula | C11H14ClN5O3S2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-3-(2-methoxyethylcarbamothioylamino)thiourea |
| SMILES | COCCNC(=S)NNC(=S)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C11H14ClN5O3S2/c1-20-5-4-13-10(21)15-16-11(22)14-9-6-7(17(18)19)2-3-8(9)12/h2-3,6H,4-5H2,1H3,(H2,13,15,21)(H2,14,16,22) |
| InChIKey | HDZHXFDATQXYAQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|