C12H14ClN3O5 — CID 108506355
N'-(2-chloro-5-nitrophenyl)-N-(3-methoxypropyl)oxamide (PubChem CID 108506355) has the molecular formula C12H14ClN3O5 and a molecular weight of 315.71 g/mol. Its IUPAC name is N'-(2-chloro-5-nitrophenyl)-N-(3-methoxypropyl)oxamide.
| Compound Name | N'-(2-chloro-5-nitrophenyl)-N-(3-methoxypropyl)oxamide |
|---|---|
| PubChem CID | 108506355 |
| Molecular Formula | C12H14ClN3O5 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N'-(2-chloro-5-nitrophenyl)-N-(3-methoxypropyl)oxamide |
| SMILES | COCCCNC(=O)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C12H14ClN3O5/c1-21-6-2-5-14-11(17)12(18)15-10-7-8(16(19)20)3-4-9(10)13/h3-4,7H,2,5-6H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | JVSADJOVSXBAOW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|