C18H14ClN3O8 — CID 108513485
dimethyl 2-[[2-(2-chloro-5-nitroanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108513485) has the molecular formula C18H14ClN3O8 and a molecular weight of 435.78 g/mol. Its IUPAC name is dimethyl 2-[[2-(2-chloro-5-nitroanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(2-chloro-5-nitroanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108513485 |
| Molecular Formula | C18H14ClN3O8 |
| Molecular Weight | 435.78 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | dimethyl 2-[[2-(2-chloro-5-nitroanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)c1 |
| InChI | InChI=1S/C18H14ClN3O8/c1-29-17(25)9-3-5-11(18(26)30-2)13(7-9)20-15(23)16(24)21-14-8-10(22(27)28)4-6-12(14)19/h3-8H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | QBEQVVZSJYCJCR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|