C17H16ClN3O7S — CID 21371778
methyl 4-chloro-3-[[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]benzoate (PubChem CID 21371778) has the molecular formula C17H16ClN3O7S and a molecular weight of 441.85 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 21371778 |
| Molecular Formula | C17H16ClN3O7S |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | methyl 4-chloro-3-[[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CN(c2cccc([N+](=O)[O-])c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H16ClN3O7S/c1-28-17(23)11-6-7-14(18)15(8-11)19-16(22)10-20(29(2,26)27)12-4-3-5-13(9-12)21(24)25/h3-9H,10H2,1-2H3,(H,19,22) |
| InChIKey | UMMVRZBGOHRRTK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|