C17H15Cl2FN2O5S — CID 2228942
methyl 4-chloro-3-[[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)acetyl]amino]benzoate (PubChem CID 2228942) has the molecular formula C17H15Cl2FN2O5S and a molecular weight of 449.29 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2228942 |
| Molecular Formula | C17H15Cl2FN2O5S |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | methyl 4-chloro-3-[[2-(3-chloro-4-fluoro-N-methylsulfonylanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CN(c2ccc(F)c(Cl)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H15Cl2FN2O5S/c1-27-17(24)10-3-5-12(18)15(7-10)21-16(23)9-22(28(2,25)26)11-4-6-14(20)13(19)8-11/h3-8H,9H2,1-2H3,(H,21,23) |
| InChIKey | VFMHRUACOYCFBJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |