C17H16ClIN2O5S — CID 2209535
methyl 4-chloro-3-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]benzoate (PubChem CID 2209535) has the molecular formula C17H16ClIN2O5S and a molecular weight of 522.75 g/mol. Its IUPAC name is methyl 4-chloro-3-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2209535 |
| Molecular Formula | C17H16ClIN2O5S |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 521.95 |
| IUPAC Name | methyl 4-chloro-3-[[2-(4-iodo-N-methylsulfonylanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H16ClIN2O5S/c1-26-17(23)11-3-8-14(18)15(9-11)20-16(22)10-21(27(2,24)25)13-6-4-12(19)5-7-13/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | AGVPDOKIKNXBCM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|