C16H16ClIN2O3S — CID 4016109
N-(4-chloro-2-methylphenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 4016109) has the molecular formula C16H16ClIN2O3S and a molecular weight of 478.74 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 4016109 |
| Molecular Formula | C16H16ClIN2O3S |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CN(c1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H16ClIN2O3S/c1-11-9-12(17)3-8-15(11)19-16(21)10-20(24(2,22)23)14-6-4-13(18)5-7-14/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | CTUWEAOHTXLTIA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|