C23H22ClIN2O3S — CID 126190406
2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 126190406) has the molecular formula C23H22ClIN2O3S and a molecular weight of 568.86 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126190406 |
| Molecular Formula | C23H22ClIN2O3S |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 568.01 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccc(I)cc2C)S(=O)(=O)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C23H22ClIN2O3S/c1-15-4-8-20(13-16(15)2)27(31(29,30)21-9-5-18(24)6-10-21)14-23(28)26-22-11-7-19(25)12-17(22)3/h4-13H,14H2,1-3H3,(H,26,28) |
| InChIKey | XEICMWQXQCWYTI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|