C22H20FIN2O4S — CID 4997215
2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 4997215) has the molecular formula C22H20FIN2O4S and a molecular weight of 554.38 g/mol. Its IUPAC name is 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4997215 |
| Molecular Formula | C22H20FIN2O4S |
| Molecular Weight | 554.38 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | 2-(4-fluoro-N-(4-methoxyphenyl)sulfonylanilino)-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(I)cc2C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H20FIN2O4S/c1-15-13-17(24)5-12-21(15)25-22(27)14-26(18-6-3-16(23)4-7-18)31(28,29)20-10-8-19(30-2)9-11-20/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | AEDPTLKQSUCYHC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|