C18H22IN3O5S2 — CID 43899916
2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 43899916) has the molecular formula C18H22IN3O5S2 and a molecular weight of 551.43 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43899916 |
| Molecular Formula | C18H22IN3O5S2 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 551.00 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CN(c1ccc(S(=O)(=O)N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H22IN3O5S2/c1-13-11-14(19)5-10-17(13)20-18(23)12-22(28(4,24)25)15-6-8-16(9-7-15)29(26,27)21(2)3/h5-11H,12H2,1-4H3,(H,20,23) |
| InChIKey | QXUILBBQSUIKFY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|