C23H23IN2O3S — CID 1210644
N-(4-iodo-2-methylphenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 1210644) has the molecular formula C23H23IN2O3S and a molecular weight of 534.42 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 1210644 |
| Molecular Formula | C23H23IN2O3S |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(I)cc2C)c2ccccc2C)cc1 |
| InChI | InChI=1S/C23H23IN2O3S/c1-16-8-11-20(12-9-16)30(28,29)26(22-7-5-4-6-17(22)2)15-23(27)25-21-13-10-19(24)14-18(21)3/h4-14H,15H2,1-3H3,(H,25,27) |
| InChIKey | JMZTUTPPQXBCJP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|