C22H20BrFN2O3S — CID 126320797
N-(4-bromo-2-fluorophenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126320797) has the molecular formula C22H20BrFN2O3S and a molecular weight of 491.38 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126320797 |
| Molecular Formula | C22H20BrFN2O3S |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-(2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(Br)cc2F)c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H20BrFN2O3S/c1-15-7-10-18(11-8-15)30(28,29)26(21-6-4-3-5-16(21)2)14-22(27)25-20-12-9-17(23)13-19(20)24/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | GNYYRTPPAFWEQJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |