C22H21IN2O3S — CID 1361630
2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(4-iodophenyl)acetamide (PubChem CID 1361630) has the molecular formula C22H21IN2O3S and a molecular weight of 520.39 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 1361630 |
| Molecular Formula | C22H21IN2O3S |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dimethylanilino]-N-(4-iodophenyl)acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccc(I)cc2)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H21IN2O3S/c1-16-8-13-21(17(2)14-16)25(29(27,28)20-6-4-3-5-7-20)15-22(26)24-19-11-9-18(23)10-12-19/h3-14H,15H2,1-2H3,(H,24,26) |
| InChIKey | YAAHNBKXMOYCLP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|