C28H26IN3O5S2 — CID 126181644
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 126181644) has the molecular formula C28H26IN3O5S2 and a molecular weight of 675.57 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 126181644 |
| Molecular Formula | C28H26IN3O5S2 |
| Molecular Weight | 675.57 g/mol |
| Exact Mass | 675.04 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)CN(c3ccc(I)cc3)S(=O)(=O)c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H26IN3O5S2/c1-20-8-17-27(21(2)18-20)31-38(34,35)25-15-11-23(12-16-25)30-28(33)19-32(24-13-9-22(29)10-14-24)39(36,37)26-6-4-3-5-7-26/h3-18,31H,19H2,1-2H3,(H,30,33) |
| InChIKey | YBAKEGFDCFLKDZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|