C31H27N3O5S2 — CID 43881129
2-[N-(benzenesulfonyl)-4-methylanilino]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide (PubChem CID 43881129) has the molecular formula C31H27N3O5S2 and a molecular weight of 585.71 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43881129 |
| Molecular Formula | C31H27N3O5S2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-methylanilino]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccc(S(=O)(=O)Nc3cccc4ccccc34)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27N3O5S2/c1-23-14-18-26(19-15-23)34(41(38,39)28-10-3-2-4-11-28)22-31(35)32-25-16-20-27(21-17-25)40(36,37)33-30-13-7-9-24-8-5-6-12-29(24)30/h2-21,33H,22H2,1H3,(H,32,35) |
| InChIKey | NPNJTTFQPDOEDX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |