C17H19IN2O3S — CID 998752
2-(2,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodophenyl)acetamide (PubChem CID 998752) has the molecular formula C17H19IN2O3S and a molecular weight of 458.32 g/mol. Its IUPAC name is 2-(2,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodophenyl)acetamide.
| Compound Name | 2-(2,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 998752 |
| Molecular Formula | C17H19IN2O3S |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 2-(2,4-dimethyl-N-methylsulfonylanilino)-N-(4-iodophenyl)acetamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccc(I)cc2)S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C17H19IN2O3S/c1-12-4-9-16(13(2)10-12)20(24(3,22)23)11-17(21)19-15-7-5-14(18)6-8-15/h4-10H,11H2,1-3H3,(H,19,21) |
| InChIKey | WTTMESTWIXVPLG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|