C17H19IN2O4S — CID 998382
N-(4-iodophenyl)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 998382) has the molecular formula C17H19IN2O4S and a molecular weight of 474.32 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(4-iodophenyl)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 998382 |
| Molecular Formula | C17H19IN2O4S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | N-(4-iodophenyl)-2-(2-methoxy-5-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(C)cc1N(CC(=O)Nc1ccc(I)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H19IN2O4S/c1-12-4-9-16(24-2)15(10-12)20(25(3,22)23)11-17(21)19-14-7-5-13(18)6-8-14/h4-10H,11H2,1-3H3,(H,19,21) |
| InChIKey | LNSBJDKWYXFVLW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|