C23H23IN2O5S — CID 1317158
2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 1317158) has the molecular formula C23H23IN2O5S and a molecular weight of 566.42 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1317158 |
| Molecular Formula | C23H23IN2O5S |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)Nc2ccc(I)cc2C)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H23IN2O5S/c1-16-13-17(24)9-11-20(16)25-23(27)15-26(32(28,29)19-7-5-4-6-8-19)21-14-18(30-2)10-12-22(21)31-3/h4-14H,15H2,1-3H3,(H,25,27) |
| InChIKey | FLGRZXKAQLGIPR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|