C23H20ClN3O7S — CID 30305481
ethyl 4-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-3-chlorobenzoate (PubChem CID 30305481) has the molecular formula C23H20ClN3O7S and a molecular weight of 517.95 g/mol. Its IUPAC name is ethyl 4-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-3-chlorobenzoate.
| Compound Name | ethyl 4-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-3-chlorobenzoate |
|---|---|
| PubChem CID | 30305481 |
| Molecular Formula | C23H20ClN3O7S |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | ethyl 4-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]amino]-3-chlorobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2cccc([N+](=O)[O-])c2)S(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C23H20ClN3O7S/c1-2-34-23(29)16-11-12-21(20(24)13-16)25-22(28)15-26(17-7-6-8-18(14-17)27(30)31)35(32,33)19-9-4-3-5-10-19/h3-14H,2,15H2,1H3,(H,25,28) |
| InChIKey | NIAWUBYRNWVRPZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|