C11H16N4O4 — CID 62241467
2-hydrazinyl-N-(3-methoxypropyl)-5-nitrobenzamide (PubChem CID 62241467) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-hydrazinyl-N-(3-methoxypropyl)-5-nitrobenzamide.
| Compound Name | 2-hydrazinyl-N-(3-methoxypropyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 62241467 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-hydrazinyl-N-(3-methoxypropyl)-5-nitrobenzamide |
| SMILES | COCCCNC(=O)c1cc([N+](=O)[O-])ccc1NN |
| InChI | InChI=1S/C11H16N4O4/c1-19-6-2-5-13-11(16)9-7-8(15(17)18)3-4-10(9)14-12/h3-4,7,14H,2,5-6,12H2,1H3,(H,13,16) |
| InChIKey | OLDSNMNYDPLIML-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|