C9H9ClN4O3S — CID 7942937
1-acetamido-3-(2-chloro-5-nitrophenyl)thiourea (PubChem CID 7942937) has the molecular formula C9H9ClN4O3S and a molecular weight of 288.72 g/mol. Its IUPAC name is 1-acetamido-3-(2-chloro-5-nitrophenyl)thiourea.
| Compound Name | 1-acetamido-3-(2-chloro-5-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 7942937 |
| Molecular Formula | C9H9ClN4O3S |
| Molecular Weight | 288.72 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 1-acetamido-3-(2-chloro-5-nitrophenyl)thiourea |
| SMILES | CC(=O)NNC(=S)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C9H9ClN4O3S/c1-5(15)12-13-9(18)11-8-4-6(14(16)17)2-3-7(8)10/h2-4H,1H3,(H,12,15)(H2,11,13,18) |
| InChIKey | JRTKDMGZAWIKSS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.72 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|