C13H15ClN4O3S — CID 7942298
4-acetyl-N-(2-chloro-5-nitrophenyl)piperazine-1-carbothioamide (PubChem CID 7942298) has the molecular formula C13H15ClN4O3S and a molecular weight of 342.81 g/mol. Its IUPAC name is 4-acetyl-N-(2-chloro-5-nitrophenyl)piperazine-1-carbothioamide.
| Compound Name | 4-acetyl-N-(2-chloro-5-nitrophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 7942298 |
| Molecular Formula | C13H15ClN4O3S |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-acetyl-N-(2-chloro-5-nitrophenyl)piperazine-1-carbothioamide |
| SMILES | CC(=O)N1CCN(C(=S)Nc2cc([N+](=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C13H15ClN4O3S/c1-9(19)16-4-6-17(7-5-16)13(22)15-12-8-10(18(20)21)2-3-11(12)14/h2-3,8H,4-7H2,1H3,(H,15,22) |
| InChIKey | ODELSWKCODFGIA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|