C16H15ClN4O3S2 — CID 8697089
N-(2-chloro-5-nitrophenyl)-4-(5-formylthiophen-2-yl)piperazine-1-carbothioamide (PubChem CID 8697089) has the molecular formula C16H15ClN4O3S2 and a molecular weight of 410.91 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-4-(5-formylthiophen-2-yl)piperazine-1-carbothioamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-4-(5-formylthiophen-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8697089 |
| Molecular Formula | C16H15ClN4O3S2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-4-(5-formylthiophen-2-yl)piperazine-1-carbothioamide |
| SMILES | O=Cc1ccc(N2CCN(C(=S)Nc3cc([N+](=O)[O-])ccc3Cl)CC2)s1 |
| InChI | InChI=1S/C16H15ClN4O3S2/c17-13-3-1-11(21(23)24)9-14(13)18-16(25)20-7-5-19(6-8-20)15-4-2-12(10-22)26-15/h1-4,9-10H,5-8H2,(H,18,25) |
| InChIKey | HDPFBRVAXKEKAW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|