C19H25ClN5O2S+ — CID 2123391
N-(2-chloro-5-nitrophenyl)-4-[2-(2,5-dimethylpyrrol-1-yl)ethyl]piperazin-4-ium-1-carbothioamide (PubChem CID 2123391) has the molecular formula C19H25ClN5O2S+ and a molecular weight of 422.96 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-4-[2-(2,5-dimethylpyrrol-1-yl)ethyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-4-[2-(2,5-dimethylpyrrol-1-yl)ethyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 2123391 |
| Molecular Formula | C19H25ClN5O2S+ |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-4-[2-(2,5-dimethylpyrrol-1-yl)ethyl]piperazin-4-ium-1-carbothioamide |
| SMILES | Cc1ccc(C)n1CC[NH+]1CCN(C(=S)Nc2cc([N+](=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C19H24ClN5O2S/c1-14-3-4-15(2)24(14)12-9-22-7-10-23(11-8-22)19(28)21-18-13-16(25(26)27)5-6-17(18)20/h3-6,13H,7-12H2,1-2H3,(H,21,28)/p+1 |
| InChIKey | IOUDDEZOROKGSF-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 67.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|