C15H12ClN3O2S — CID 7942829
N-(2-chloro-5-nitrophenyl)-2,3-dihydroindole-1-carbothioamide (PubChem CID 7942829) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2,3-dihydroindole-1-carbothioamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 7942829 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2,3-dihydroindole-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(NC(=S)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H12ClN3O2S/c16-12-6-5-11(19(20)21)9-13(12)17-15(22)18-8-7-10-3-1-2-4-14(10)18/h1-6,9H,7-8H2,(H,17,22) |
| InChIKey | VISCCEOMDGSMSR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|