C15H13N3O2S — CID 19686640
N-(3-nitrophenyl)-2,3-dihydroindole-1-carbothioamide (PubChem CID 19686640) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2,3-dihydroindole-1-carbothioamide.
| Compound Name | N-(3-nitrophenyl)-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 19686640 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(3-nitrophenyl)-2,3-dihydroindole-1-carbothioamide |
| SMILES | O=[N+]([O-])c1cccc(NC(=S)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H13N3O2S/c19-18(20)13-6-3-5-12(10-13)16-15(21)17-9-8-11-4-1-2-7-14(11)17/h1-7,10H,8-9H2,(H,16,21) |
| InChIKey | SBIZQOZXGANICG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|