C19H18N4O5 — CID 7666370
(2Z)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]imino-N-(3-nitrophenyl)acetamide (PubChem CID 7666370) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is (2Z)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]imino-N-(3-nitrophenyl)acetamide.
| Compound Name | (2Z)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]imino-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7666370 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (2Z)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]imino-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(/C=N\OCC(=O)N1CCCc2ccccc21)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N4O5/c24-18(21-15-7-3-8-16(11-15)23(26)27)12-20-28-13-19(25)22-10-4-6-14-5-1-2-9-17(14)22/h1-3,5,7-9,11-12H,4,6,10,13H2,(H,21,24)/b20-12- |
| InChIKey | LQXGRJMYWGRSHT-NDENLUEZSA-N |
| XLogP | 2.52 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|