C17H22N4O5 — CID 7666500
N-cyclohexyl-N-methyl-2-[(Z)-[2-(3-nitroanilino)-2-oxoethylidene]amino]oxyacetamide (PubChem CID 7666500) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-[(Z)-[2-(3-nitroanilino)-2-oxoethylidene]amino]oxyacetamide.
| Compound Name | N-cyclohexyl-N-methyl-2-[(Z)-[2-(3-nitroanilino)-2-oxoethylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 7666500 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-[(Z)-[2-(3-nitroanilino)-2-oxoethylidene]amino]oxyacetamide |
| SMILES | CN(C(=O)CO/N=C\C(=O)Nc1cccc([N+](=O)[O-])c1)C1CCCCC1 |
| InChI | InChI=1S/C17H22N4O5/c1-20(14-7-3-2-4-8-14)17(23)12-26-18-11-16(22)19-13-6-5-9-15(10-13)21(24)25/h5-6,9-11,14H,2-4,7-8,12H2,1H3,(H,19,22)/b18-11- |
| InChIKey | PTBYZXVZOLCSED-WQRHYEAKSA-N |
| XLogP | 2.33 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|