C14H16N4O6 — CID 7667368
N-cyclopropyl-2-[(Z)-[2-(2-methoxy-4-nitroanilino)-2-oxoethylidene]amino]oxyacetamide (PubChem CID 7667368) has the molecular formula C14H16N4O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is N-cyclopropyl-2-[(Z)-[2-(2-methoxy-4-nitroanilino)-2-oxoethylidene]amino]oxyacetamide.
| Compound Name | N-cyclopropyl-2-[(Z)-[2-(2-methoxy-4-nitroanilino)-2-oxoethylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 7667368 |
| Molecular Formula | C14H16N4O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-cyclopropyl-2-[(Z)-[2-(2-methoxy-4-nitroanilino)-2-oxoethylidene]amino]oxyacetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)/C=N\OCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H16N4O6/c1-23-12-6-10(18(21)22)4-5-11(12)17-13(19)7-15-24-8-14(20)16-9-2-3-9/h4-7,9H,2-3,8H2,1H3,(H,16,20)(H,17,19)/b15-7- |
| InChIKey | WSNPCKOUSVVUCI-CHHVJCJISA-N |
| XLogP | 0.82 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|