C16H20ClN3O4 — CID 7666999
2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-cyclopentylacetamide (PubChem CID 7666999) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is 2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-cyclopentylacetamide.
| Compound Name | 2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 7666999 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-cyclopentylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C=N\OCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20ClN3O4/c1-23-14-7-6-11(17)8-13(14)20-15(21)9-18-24-10-16(22)19-12-4-2-3-5-12/h6-9,12H,2-5,10H2,1H3,(H,19,22)(H,20,21)/b18-9- |
| InChIKey | PSRACCVLQUKBPJ-NVMNQCDNSA-N |
| XLogP | 2.35 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|