C18H24ClN3O4 — CID 7667186
2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-[(1R,2S)-2-methylcyclohexyl]acetamide (PubChem CID 7667186) has the molecular formula C18H24ClN3O4 and a molecular weight of 381.86 g/mol. Its IUPAC name is 2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-[(1R,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7667186 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[(Z)-[2-(5-chloro-2-methoxyanilino)-2-oxoethylidene]amino]oxy-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C=N\OCC(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C18H24ClN3O4/c1-12-5-3-4-6-14(12)21-18(24)11-26-20-10-17(23)22-15-9-13(19)7-8-16(15)25-2/h7-10,12,14H,3-6,11H2,1-2H3,(H,21,24)(H,22,23)/b20-10-/t12-,14+/m0/s1 |
| InChIKey | LPTAKUNVCSEXEA-VTRSUIGVSA-N |
| XLogP | 2.98 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|