C24H29ClN2O4 — CID 4535395
2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxy-N-(2-methylcyclohexyl)acetamide (PubChem CID 4535395) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxy-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxy-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 4535395 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxy-N-(2-methylcyclohexyl)acetamide |
| SMILES | COc1cc(C=NOCC(=O)NC2CCCCC2C)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H29ClN2O4/c1-17-5-3-4-6-21(17)27-24(28)16-31-26-14-19-9-12-22(23(13-19)29-2)30-15-18-7-10-20(25)11-8-18/h7-14,17,21H,3-6,15-16H2,1-2H3,(H,27,28) |
| InChIKey | LSDGMVNKTSYDPM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|