C23H20ClFN2O4 — CID 4265176
N-(4-chlorophenyl)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxyacetamide (PubChem CID 4265176) has the molecular formula C23H20ClFN2O4 and a molecular weight of 442.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxyacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 4265176 |
| Molecular Formula | C23H20ClFN2O4 |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxyacetamide |
| SMILES | COc1cc(C=NOCC(=O)Nc2ccc(Cl)cc2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20ClFN2O4/c1-29-22-12-17(4-11-21(22)30-14-16-2-7-19(25)8-3-16)13-26-31-15-23(28)27-20-9-5-18(24)6-10-20/h2-13H,14-15H2,1H3,(H,27,28) |
| InChIKey | RXMPNQIIXQAGHK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|