C24H22F2N2O5 — CID 6893064
N-[4-(difluoromethoxy)phenyl]-2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide (PubChem CID 6893064) has the molecular formula C24H22F2N2O5 and a molecular weight of 456.45 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 6893064 |
| Molecular Formula | C24H22F2N2O5 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide |
| SMILES | COc1cc(/C=N/OCC(=O)Nc2ccc(OC(F)F)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22F2N2O5/c1-30-22-13-18(7-12-21(22)31-15-17-5-3-2-4-6-17)14-27-32-16-23(29)28-19-8-10-20(11-9-19)33-24(25)26/h2-14,24H,15-16H2,1H3,(H,28,29)/b27-14+ |
| InChIKey | VMGUYXNMCYHGEQ-MZJWZYIUSA-N |
| XLogP | 4.86 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|