C25H26N2O4 — CID 3894304
N-(2,4-dimethylphenyl)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide (PubChem CID 3894304) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 3894304 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxyacetamide |
| SMILES | COc1cc(C=NOCC(=O)Nc2ccc(C)cc2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O4/c1-18-9-11-22(19(2)13-18)27-25(28)17-31-26-15-21-10-12-23(24(14-21)29-3)30-16-20-7-5-4-6-8-20/h4-15H,16-17H2,1-3H3,(H,27,28) |
| InChIKey | QEZQZGDQZINNHV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|