C25H24ClNO5 — CID 2457541
1-[3-[[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone (PubChem CID 2457541) has the molecular formula C25H24ClNO5 and a molecular weight of 453.92 g/mol. Its IUPAC name is 1-[3-[[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone.
| Compound Name | 1-[3-[[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 2457541 |
| Molecular Formula | C25H24ClNO5 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 1-[3-[[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone |
| SMILES | COc1ccc(C(C)=O)cc1CON=Cc1ccc(OCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H24ClNO5/c1-17(28)20-7-11-23(29-2)21(13-20)16-32-27-14-19-6-10-24(25(12-19)30-3)31-15-18-4-8-22(26)9-5-18/h4-14H,15-16H2,1-3H3 |
| InChIKey | JMZNBAZKECZXOF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|