About (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate
(4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 19185071) has the molecular formula C25H21ClO5
and a molecular weight of 436.89 g/mol. Its IUPAC name is (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate.
Molecular Properties
| Compound Name | (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| PubChem CID | 19185071 |
| Molecular Formula | C25H21ClO5 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc(C(C)=O)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21ClO5/c1-17(27)20-7-11-22(12-8-20)31-25(28)14-6-18-5-13-23(24(15-18)29-2)30-16-19-3-9-21(26)10-4-19/h3-15H,16H2,1-2H3/b14-6+ |
| InChIKey | PXSRECMLXLZNSB-MKMNVTDBSA-N |
| XLogP | 5.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate?
The IUPAC name of (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate (CID 19185071) is (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate.
What is the SMILES notation for (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate?
The canonical SMILES for (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate is COc1cc(/C=C/C(=O)Oc2ccc(C(C)=O)cc2)ccc1OCc1ccc(Cl)cc1.
What is the InChIKey of (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate?
The InChIKey is PXSRECMLXLZNSB-MKMNVTDBSA-N. The full InChI is InChI=1S/C25H21ClO5/c1-17(27)20-7-11-22(12-8-20)31-25(28)14-6-18-5-13-23(24(15-18)29-2)30-16-19-3-9-21(26)10-4-19/h3-15H,16H2,1-2H3/b14-6+.
What are the key properties of (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate?
(4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate has a molecular weight of 436.89 g/mol, XLogP of 5.75, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetylphenyl) (E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoate is sourced from PubChem (CID 19185071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).