C24H20ClNO6 — CID 108753921
3-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-hydroxybenzoic acid (PubChem CID 108753921) has the molecular formula C24H20ClNO6 and a molecular weight of 453.88 g/mol. Its IUPAC name is 3-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753921 |
| Molecular Formula | C24H20ClNO6 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-[[(E)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoyl]amino]-4-hydroxybenzoic acid |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(C(=O)O)ccc2O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClNO6/c1-31-22-12-15(4-10-21(22)32-14-16-2-7-18(25)8-3-16)5-11-23(28)26-19-13-17(24(29)30)6-9-20(19)27/h2-13,27H,14H2,1H3,(H,26,28)(H,29,30)/b11-5+ |
| InChIKey | GSZJYYFNVBKMOH-VZUCSPMQSA-N |
| XLogP | 4.98 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|