C20H21NO6 — CID 28686572
3-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid (PubChem CID 28686572) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 28686572 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-methoxybenzoic acid |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2cc(C(=O)O)ccc2OC)cc1OC |
| InChI | InChI=1S/C20H21NO6/c1-4-27-17-8-5-13(11-18(17)26-3)6-10-19(22)21-15-12-14(20(23)24)7-9-16(15)25-2/h5-12H,4H2,1-3H3,(H,21,22)(H,23,24)/b10-6+ |
| InChIKey | VEESPQOZJPZTST-UXBLZVDNSA-N |
| XLogP | 3.45 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|