C21H23NO5 — CID 35249748
methyl 4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoate (PubChem CID 35249748) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoate.
| Compound Name | methyl 4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 35249748 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl 4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoate |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2ccc(C(=O)OC)cc2C)cc1OC |
| InChI | InChI=1S/C21H23NO5/c1-5-27-18-10-6-15(13-19(18)25-3)7-11-20(23)22-17-9-8-16(12-14(17)2)21(24)26-4/h6-13H,5H2,1-4H3,(H,22,23)/b11-7+ |
| InChIKey | CDZSFKODIOMAFE-YRNVUSSQSA-N |
| XLogP | 3.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|