C29H32N2O6 — CID 19185153
N-[2,5-diethoxy-4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide (PubChem CID 19185153) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 19185153 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | N-[2,5-diethoxy-4-[[(E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)/C=C/c1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C29H32N2O6/c1-5-35-24-15-13-20(17-27(24)34-4)14-16-28(32)30-22-18-26(37-7-3)23(19-25(22)36-6-2)31-29(33)21-11-9-8-10-12-21/h8-19H,5-7H2,1-4H3,(H,30,32)(H,31,33)/b16-14+ |
| InChIKey | OWEXKFVPFZLUDT-JQIJEIRASA-N |
| XLogP | 5.80 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|