C26H26N2O5 — CID 4642812
N-[4-[3-(4-ethoxyphenyl)prop-2-enoylamino]-2,5-dimethoxyphenyl]benzamide (PubChem CID 4642812) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is N-[4-[3-(4-ethoxyphenyl)prop-2-enoylamino]-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-[3-(4-ethoxyphenyl)prop-2-enoylamino]-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 4642812 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[4-[3-(4-ethoxyphenyl)prop-2-enoylamino]-2,5-dimethoxyphenyl]benzamide |
| SMILES | CCOc1ccc(C=CC(=O)Nc2cc(OC)c(NC(=O)c3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C26H26N2O5/c1-4-33-20-13-10-18(11-14-20)12-15-25(29)27-21-16-24(32-3)22(17-23(21)31-2)28-26(30)19-8-6-5-7-9-19/h5-17H,4H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | FAEDBXHDRRBYSP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|