C29H32N2O5 — CID 19181852
N-[2,5-diethoxy-4-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide (PubChem CID 19181852) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 19181852 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[2,5-diethoxy-4-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]phenyl]benzamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)Nc2cc(OCC)c(NC(=O)c3ccccc3)cc2OCC)cc1 |
| InChI | InChI=1S/C29H32N2O5/c1-4-18-36-23-15-12-21(13-16-23)14-17-28(32)30-24-19-27(35-6-3)25(20-26(24)34-5-2)31-29(33)22-10-8-7-9-11-22/h7-17,19-20H,4-6,18H2,1-3H3,(H,30,32)(H,31,33)/b17-14+ |
| InChIKey | PFKRUYXHHUSQEG-SAPNQHFASA-N |
| XLogP | 6.18 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|