C24H23BrN2O5 — CID 35865429
N-[4-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide (PubChem CID 35865429) has the molecular formula C24H23BrN2O5 and a molecular weight of 499.36 g/mol. Its IUPAC name is N-[4-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide.
| Compound Name | N-[4-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 35865429 |
| Molecular Formula | C24H23BrN2O5 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | N-[4-[[(E)-3-(5-bromofuran-2-yl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)/C=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C24H23BrN2O5/c1-3-30-20-15-19(27-24(29)16-8-6-5-7-9-16)21(31-4-2)14-18(20)26-23(28)13-11-17-10-12-22(25)32-17/h5-15H,3-4H2,1-2H3,(H,26,28)(H,27,29)/b13-11+ |
| InChIKey | VTLHPVQTNJEFPQ-ACCUITESSA-N |
| XLogP | 5.74 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|