C19H23BrN2O5S — CID 26756004
(E)-3-(5-bromofuran-2-yl)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]prop-2-enamide (PubChem CID 26756004) has the molecular formula C19H23BrN2O5S and a molecular weight of 471.37 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26756004 |
| Molecular Formula | C19H23BrN2O5S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C=C/c2ccc(Br)o2)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C19H23BrN2O5S/c1-4-22(5-2)28(24,25)17-13-14(7-10-16(17)26-6-3)21-19(23)12-9-15-8-11-18(20)27-15/h7-13H,4-6H2,1-3H3,(H,21,23)/b12-9+ |
| InChIKey | DBKZRKTVOBYYBF-FMIVXFBMSA-N |
| XLogP | 4.12 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|